For research use only. Not for therapeutic Use.
BOC-4-ABZ-OSU is a chemical compound used in peptide synthesis and pharmaceutical research. It consists of a BOC (tert-butyloxycarbonyl) protected amino group, 4-aminobenzoic acid (4-ABZ), and a reactive N-hydroxysuccinimide (OSU) ester. This combination allows it to act as a coupling reagent, facilitating the attachment of amino acids to form peptides. BOC-4-ABZ-OSU is particularly valuable in solid-phase peptide synthesis, helping to protect and activate functional groups during the process, contributing to the development of peptide-based drugs and biomolecules.
Catalog Number | M026685 |
CAS Number | 120465-50-1 |
Molecular Formula | C16H18N2O6 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
InChI | InChI=1S/C16H18N2O6/c1-16(2,3)23-15(22)17-11-6-4-10(5-7-11)14(21)24-18-12(19)8-9-13(18)20/h4-7H,8-9H2,1-3H3,(H,17,22) |
InChIKey | CVLCMHYNOJASNT-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C(=O)ON2C(=O)CCC2=O |