For research use only. Not for therapeutic Use.
Boc-Ala-OH-1-13C(Cat No.:S000707) is a labeled form of Boc-Ala-OH, where the first carbon atom is enriched with carbon-13, enhancing its detectability for analytical studies such as NMR spectroscopy and mass spectrometry. This isotopic labeling is especially useful in peptide synthesis, allowing researchers to monitor and analyze the incorporation and behavior of the alanine residue within peptides. Boc-Ala-OH, an alanine derivative protected by a tert-butoxycarbonyl (Boc) group, is commonly used in peptide synthesis to prevent unwanted side reactions at the amino group. The 13C labeling provides precise insights into peptide dynamics and stability.
CAS Number | 201740-78-5 |
Molecular Formula | C713CH15NO4 |
Purity | ≥95% |
IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino](113C)propanoic acid |
InChI | InChI=1S/C8H15NO4/c1-5(6(10)11)9-7(12)13-8(2,3)4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m0/s1/i6+1 |
InChIKey | QVHJQCGUWFKTSE-SANWUMGISA-N |
SMILES | CC(C(=O)O)NC(=O)OC(C)(C)C |