For research use only. Not for therapeutic Use.
Boc-aminooxy-PEG2-propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Boc-aminooxy-PEG2-propargyl is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
| Catalog Number | I016142 |
| CAS Number | 1895922-74-3 |
| Synonyms | tert-butyl N-[2-(2-prop-2-ynoxyethoxy)ethoxy]carbamate |
| Molecular Formula | C12H21NO5 |
| Purity | ≥95% |
| InChI | InChI=1S/C12H21NO5/c1-5-6-15-7-8-16-9-10-17-13-11(14)18-12(2,3)4/h1H,6-10H2,2-4H3,(H,13,14) |
| InChIKey | XXPUFYWATPLMHN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NOCCOCCOCC#C |
| Reference | [1]. An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 |
