For research use only. Not for therapeutic Use.
Boc-Asn-ONp is a protected derivative of asparagine, featuring a tert-butyloxycarbonyl (Boc) group at the α-amino position and a nitrophenyl (ONp) group at the side chain carboxamide. This compound is valuable in peptide synthesis, as the Boc group protects the amine during coupling reactions while allowing for selective deprotection under mild conditions. The nitrophenyl moiety enhances the compound’s reactivity and serves as a useful leaving group in coupling reactions. This compound is crucial in developing peptides for medicinal and research applications.
CAS Number | 4587-33-1 |
Molecular Formula | C15H19N3O7 |
Purity | ≥95% |
IUPAC Name | (4-nitrophenyl) (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
InChI | InChI=1S/C15H19N3O7/c1-15(2,3)25-14(21)17-11(8-12(16)19)13(20)24-10-6-4-9(5-7-10)18(22)23/h4-7,11H,8H2,1-3H3,(H2,16,19)(H,17,21)/t11-/m0/s1 |
InChIKey | IAPXDJMULQXGDD-NSHDSACASA-N |
SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N)C(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |