For research use only. Not for therapeutic Use.
BOC-D-4,4′-BIPHENYLALANINE (Cat.No:M114280) is a compound used in peptide synthesis. It contains a BOC (tert-butoxycarbonyl) protective group and a modified form of the amino acid phenylalanine. This compound plays a crucial role in creating customized peptides for research and pharmaceutical applications, allowing for precise control over peptide structure and function.
CAS Number | 128779-47-5 |
Molecular Formula | C20H23NO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenylphenyl)propanoic acid |
InChI | InChI=1S/C20H23NO4/c1-20(2,3)25-19(24)21-17(18(22)23)13-14-9-11-16(12-10-14)15-7-5-4-6-8-15/h4-12,17H,13H2,1-3H3,(H,21,24)(H,22,23)/t17-/m1/s1 |
InChIKey | NBVVKAUSAGHTSU-QGZVFWFLSA-N |
SMILES | CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)C2=CC=CC=C2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |