For research use only. Not for therapeutic Use.
Boc-D-Homoallylglycine(Cat No.:L010963)is a derivative of the amino acid homoallylglycine, featuring a Boc (tert-butoxycarbonyl) protecting group on the amine. This compound is commonly used in peptide synthesis and pharmaceutical research, particularly for introducing non-natural amino acids into peptide chains. The homoallylglycine residue contains an extended carbon chain with an allyl group, providing unique conformational properties and reactivity. The Boc group protects the amine during synthesis, allowing for selective deprotection and further functionalization. High purity and stability make Boc-D-Homoallylglycine essential for advanced peptide chemistry and drug development.
CAS Number | 219819-76-8 |
Molecular Formula | C11H19NO4 |
Purity | ≥95% |
IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoic acid |
InChI | InChI=1S/C11H19NO4/c1-5-6-7-8(9(13)14)12-10(15)16-11(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,12,15)(H,13,14)/t8-/m1/s1 |
InChIKey | LQIMZUPFMSNHTM-MRVPVSSYSA-N |
SMILES | CC(C)(C)OC(=O)NC(CCC=C)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |