For research use only. Not for therapeutic Use.
Boc-Leu-OH·H2O-d3（Cat No.:S000724） is a deuterated form of Boc-Leu-OH·H2O, where three hydrogen atoms are replaced with deuterium, enhancing its molecular stability and making it highly suitable as an internal standard in analytical methods such as mass spectrometry and NMR spectroscopy. Boc-Leu-OH·H2O refers to N-tert-butoxycarbonyl-L-leucine, a protected amino acid used in peptide synthesis, with water of hydration. The introduction of deuterium into Boc-Leu-OH·H2O-d3 allows for more precise pharmacokinetic and metabolic studies, providing clearer insights into its behavior during peptide synthesis and its interactions within various biological and chemical systems.
| Catalog Number | S000724 |
| CAS Number | 203645-42-5 |
| Molecular Formula | C11H20D3NO5 |
| Purity | ≥95% |
| IUPAC Name | (2S)-5,5,5-trideuterio-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate |
| InChI | InChI=1S/C11H21NO4.H2O/c1-7(2)6-8(9(13)14)12-10(15)16-11(3,4)5;/h7-8H,6H2,1-5H3,(H,12,15)(H,13,14);1H2/t8-;/m0./s1/i1D3;/t7?,8-; |
| InChIKey | URQQEIOTRWJXBA-ASKMLXMYSA-N |
| SMILES | CC(C)CC(C(=O)O)NC(=O)OC(C)(C)C.O |
