For research use only. Not for therapeutic Use.
Boc-Lys(Fmoc)-OH(Cat No.:L014479)is a protected lysine derivative widely used in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS). This compound features a lysine amino acid with a tert-butyloxycarbonyl (Boc) group protecting the α-amino group and a 9-fluorenylmethyloxycarbonyl (Fmoc) group protecting the ε-amino group. These protective groups prevent undesired reactions during synthesis, allowing for precise chain elongation and sequence-specific peptide formation. Boc-Lys(Fmoc)-OH is essential in producing complex peptides and proteins, supporting research in biochemistry, drug development, and molecular biology.
Catalog Number | L014479 |
CAS Number | 84624-27-1 |
Molecular Formula | C26H32N2O6 |
Purity | ≥95% |
IUPAC Name | (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
InChI | InChI=1S/C26H32N2O6/c1-26(2,3)34-25(32)28-22(23(29)30)14-8-9-15-27-24(31)33-16-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h4-7,10-13,21-22H,8-9,14-16H2,1-3H3,(H,27,31)(H,28,32)(H,29,30)/t22-/m0/s1 |
InChIKey | JYEVQYFWINBXJU-QFIPXVFZSA-N |
SMILES | CC(C)(C)OC(=O)NC(CCCCNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O |