For research use only. Not for therapeutic Use.
Boc-NH-PEG5-CH2CH2COOH is a PEG-based PROTAC linker that plays a crucial role in the synthesis of PROTACs (proteolysis-targeting chimeras). This linker consists of a tert-butyloxycarbonyl (Boc) protected amine group, a polyethylene glycol (PEG) spacer with five ethylene glycol units, and a carboxylic acid (CH2CH2COOH) at the end. The PEG spacer imparts flexibility and hydrophilicity to the PROTAC molecule, while the Boc protecting group ensures stability during synthesis. This linker allows for the conjugation of different ligands to target proteins of interest, facilitating the recruitment of E3 ligases and subsequent targeted protein degradation.
| Catalog Number | I016725 |
| CAS Number | 1347750-78-0 |
| Molecular Formula | C₁₈H₃₅NO₉ |
| Purity | ≥95% |
| Target | PROTAC Linkers |
| Storage | 2-8°C |
| IUPAC Name | 3-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C18H35NO9/c1-18(2,3)28-17(22)19-5-7-24-9-11-26-13-15-27-14-12-25-10-8-23-6-4-16(20)21/h4-15H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | RVYBVZICXVYKRD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCC(=O)O |
| Reference | [1]. Nathanael Gray, et al. Bifunctional compounds for her3 degradation and methods of use. WO2017117474A1. |
