For research use only. Not for therapeutic Use.
Bocconoline（Cat No.:I043346）is a chemical compound used in peptide synthesis and organic chemistry. It contains a Boc (tert-butoxycarbonyl) protecting group, commonly used to protect amino groups during peptide chain elongation. Bocconoline’s structure allows it to be used as a building block for constructing peptides with specific functionalities. This compound is particularly valuable in the design of bioactive peptides, where controlled deprotection of the Boc group allows for the selective formation of desired peptide sequences. Bocconoline plays an essential role in developing peptides for research applications, including drug discovery and biomolecular studies.
| CAS Number | 32906-88-0 |
| Synonyms | (1,2-dimethoxy-12-methyl-13H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl)methanol |
| Molecular Formula | C22H21NO5 |
| Purity | ≥95% |
| IUPAC Name | (1,2-dimethoxy-12-methyl-13H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl)methanol |
| InChI | InChI=1S/C22H21NO5/c1-23-16(10-24)20-13(6-7-17(25-2)22(20)26-3)14-5-4-12-8-18-19(28-11-27-18)9-15(12)21(14)23/h4-9,16,24H,10-11H2,1-3H3 |
| InChIKey | GKBDCSXIKLSKMH-UHFFFAOYSA-N |
| SMILES | CN1C(C2=C(C=CC(=C2OC)OC)C3=C1C4=CC5=C(C=C4C=C3)OCO5)CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
