For research use only. Not for therapeutic Use.
BODIPY FL thalidomide（Cat No.:I042274）is a chemical compound that combines the fluorescent dye BODIPY FL with thalidomide, a drug known for its immunomodulatory and anti-inflammatory properties. The BODIPY FL group enables easy tracking and visualization of thalidomide’s interactions in biological systems using fluorescence microscopy. This combination is often used in research to study the pharmacokinetics, distribution, and cellular uptake of thalidomide and its derivatives. It helps scientists better understand the drug’s mechanisms of action, its effects on different cell types, and its potential therapeutic applications in diseases like cancer and autoimmune disorders.
| Catalog Number | I042274 |
| CAS Number | 2740620-18-0 |
| Molecular Formula | C37H43BF2N6O7 |
| Purity | ≥95% |
| IUPAC Name | 3-(2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)-N-[8-[[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl]amino]octyl]propanamide |
| InChI | InChI=1S/C37H43BF2N6O7/c1-23-20-24(2)45-29(23)21-26-13-12-25(46(26)38(45,39)40)14-16-31(47)41-18-7-5-3-4-6-8-19-42-33(49)22-53-30-11-9-10-27-34(30)37(52)44(36(27)51)28-15-17-32(48)43-35(28)50/h9-13,20-21,28H,3-8,14-19,22H2,1-2H3,(H,41,47)(H,42,49)(H,43,48,50) |
| InChIKey | CJILTFJYYOHLGA-UHFFFAOYSA-N |
| SMILES | [B-]1(N2C(=CC(=C2C=C3[N+]1=C(C=C3)CCC(=O)NCCCCCCCCNC(=O)COC4=CC=CC5=C4C(=O)N(C5=O)C6CCC(=O)NC6=O)C)C)(F)F |
