For research use only, not for therapeutic use.
Bomedemstat free base（Cat No.:I023611）is a selective inhibitor of the enzyme LSD1 (lysine-specific demethylase 1), which plays a crucial role in regulating histone methylation and gene expression. By inhibiting LSD1, bomedemstat can lead to the reactivation of silenced tumor suppressor genes, making it a promising candidate in cancer therapy, particularly for hematologic malignancies and solid tumors. Preclinical studies have shown its potential to enhance antitumor effects when combined with other therapies. Bomedemstat’s unique mechanism of action highlights its relevance in epigenetic research and targeted treatment strategies for various cancers.
| Catalog Number | I023611 |
| CAS Number | 1990504-34-1 |
| Synonyms | Bomedemstat, IMG-7289; IMG 7289; IMG7289; |
| Molecular Formula | C28H34FN7O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]-4-(triazol-1-yl)benzamide |
| InChI | InChI=1S/C28H34FN7O2/c1-34-15-17-35(18-16-34)28(38)25(3-2-12-30-26-19-24(26)20-4-8-22(29)9-5-20)32-27(37)21-6-10-23(11-7-21)36-14-13-31-33-36/h4-11,13-14,24-26,30H,2-3,12,15-19H2,1H3,(H,32,37)/t24-,25-,26+/m0/s1 |
| InChIKey | KQKBMHGOHXOHTD-KKUQBAQOSA-N |
| SMILES | CN1CCN(CC1)C(=O)[C@H](CCCN[C@@H]2C[C@H]2C3=CC=C(C=C3)F)NC(=O)C4=CC=C(C=C4)N5C=CN=N5 |
| Reference | 1: Fu X, Zhang P, Yu B. Advances toward LSD1 inhibitors for cancer therapy. Future Med Chem. 2017 Jul;9(11):1227-1242. doi: 10.4155/fmc-2017-0068. Epub 2017 Jul 19. Review. PubMed PMID: 28722477. |
