For research use only. Not for therapeutic Use.
Bonducellin is a naturally occurring compound isolated from the seeds of Caesalpinia bonducella, a plant known for its traditional medicinal uses. This flavonoid has demonstrated various biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties. It is of interest in pharmaceutical research for its potential therapeutic applications in treating conditions like diabetes, inflammatory diseases, and infections. Bonducellin’s ability to modulate key biochemical pathways makes it a promising candidate for drug development. Its natural origin and diverse bioactivity continue to make it a subject of ongoing studies in both traditional and modern medicine.
CAS Number | 83162-84-9 |
Molecular Formula | C17H14O4 |
Purity | ≥95% |
Target | Plants |
Storage | -20°C |
IUPAC Name | (3E)-7-hydroxy-3-[(4-methoxyphenyl)methylidene]chromen-4-one |
InChI | InChI=1S/C17H14O4/c1-20-14-5-2-11(3-6-14)8-12-10-21-16-9-13(18)4-7-15(16)17(12)19/h2-9,18H,10H2,1H3/b12-8+ |
InChIKey | DLQSYZMPSWHYMW-XYOKQWHBSA-N |
SMILES | COC1=CC=C(C=C1)C=C2COC3=C(C2=O)C=CC(=C3)O |