For research use only. Not for therapeutic Use.
Bonducellpin D(Cat No.:R005775)is a potent natural compound derived from Bonducella indica, a plant known for its therapeutic properties. This bioactive molecule exhibits promising anti-inflammatory, antimicrobial, and anticancer activities. Bonducellpin D’s mechanism of action involves inhibiting key enzymes and cellular pathways that promote disease progression, making it a candidate for developing novel treatments for infections and cancer. Its selective bioactivity and low toxicity profile make it an attractive lead compound for pharmaceutical research. Bonducellpin D holds significant potential for further exploration in drug discovery and development.
CAS Number | 197781-85-4 |
Molecular Formula | C22H28O7 |
Purity | ≥95% |
Target | SARS-CoV |
IUPAC Name | [(1S,8S,11R,12S,13R,17S,18S,19R)-13,17-dihydroxy-14,14,18-trimethyl-9-oxo-4,10-dioxapentacyclo[9.7.1.03,7.08,19.013,18]nonadeca-3(7),5-dien-12-yl] acetate |
InChI | InChI=1S/C22H28O7/c1-10(23)28-18-17-16-12(9-13-11(6-8-27-13)15(16)19(25)29-17)21(4)14(24)5-7-20(2,3)22(18,21)26/h6,8,12,14-18,24,26H,5,7,9H2,1-4H3/t12-,14-,15+,16+,17+,18-,21-,22+/m0/s1 |
InChIKey | WIKUZWCBCFNRHH-ZCQRYNMDSA-N |
SMILES | CC(=O)O[C@H]1[C@H]2[C@@H]3[C@H](CC4=C([C@H]3C(=O)O2)C=CO4)[C@@]5([C@@]1(C(CC[C@@H]5O)(C)C)O)C |