For research use only. Not for therapeutic Use.
Borate(1-), tetrafluoro-, mono-n-butylammonium salt(Cat No.:I023618)is a chemical compound consisting of a tetrafluoroborate anion (BF4-) paired with a mono-n-butylammonium cation. This salt is used in various industrial and chemical applications, including as an electrolyte in electrochemical processes, such as lithium-ion batteries, or as a stabilizer in certain formulations. It may also be involved in catalysis or as a solvent in chemical reactions, providing stability due to its non-reactive nature. While it is generally considered safe, its toxicity and environmental impact should be assessed based on specific use cases.
CAS Number | 71852-73-8 |
Synonyms | Borate(1-), tetrafluoro-, mono-n-butylammonium salt |
Molecular Formula | C4H12BF4N |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | butylazanium;tetrafluoroborate |
InChI | InChI=1S/C4H11N.BF4/c1-2-3-4-5;2-1(3,4)5/h2-5H2,1H3;/q;-1/p+1 |
InChIKey | NPRPGAZEBACOGF-UHFFFAOYSA-O |
SMILES | [B-](F)(F)(F)F.CCCC[NH3+] |