For research use only. Not for therapeutic Use.
Boric-10B acid(Cat No.:M059528), is a chemical compound enriched with the isotope boron-10 (10B). It is used in various applications, including nuclear technology and medical research. Due to its unique properties, boric-10B acid is employed in boron neutron capture therapy (BNCT), a medical treatment for certain cancers. In BNCT, tumor cells are targeted with boron-10B, and when exposed to neutrons, nuclear reactions occur, releasing particles that selectively damage the cancer cells. This technique offers a potential alternative or complement to conventional cancer treatments, showcasing the diverse applications of isotopically enriched compounds in medicine and science.
Catalog Number | M059528 |
CAS Number | 13813-79-1 |
Molecular Formula | BH3O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | trihydroxyborane |
InChI | InChI=1S/BH3O3/c2-1(3)4/h2-4H/i1-1 |
InChIKey | KGBXLFKZBHKPEV-BJUDXGSMSA-N |
SMILES | B(O)(O)O |