For research use only. Not for therapeutic Use.
<p>
Boscalid (CAS 188425-85-6) is a<span style="font-size: 16px; color: rgb(33, 33, 33); font-family: -apple-system, system-ui, "Segoe UI", Roboto, Oxygen, Oxygen-Sans, Ubuntu, Cantarell, "Fira Sans", "Droid Sans", "Helvetica Neue", "Source Sans Pro", sans-serif; font-variant-ligatures: normal; orphans: 2; widows: 2;"> </span><span style="color:#000000;"><span style="font-size: 16px; font-family: -apple-system, system-ui, "Segoe UI", Roboto, Oxygen, Oxygen-Sans, Ubuntu, Cantarell, "Fira Sans", "Droid Sans", "Helvetica Neue", "Source Sans Pro", sans-serif; font-variant-ligatures: normal; orphans: 2; widows: 2;"><span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;">fungicide active against a broad range of fungal pathogens.</span></span></span><span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;"><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">Its mode of action involves binding to the enzyme succinate dehydrogenase in mitochondria and thus inhibits the fungal respiration.</span></span></span></span></p>
| Catalog Number | R059053 |
| CAS Number | 188425-85-6 |
| Synonyms | 2-Chloro-N-(4’-chloro[1,1’-biphenyl]-2-yl)-3-pyridinecarboxamide; 2-Chloro-N-(4’-chlorobiphenyl-2-yl)nicotinamide; BAS 510F; Cantus; Emerald (fungicide); Endura; F 510; Filan; Nicobifen; |
| Molecular Formula | C18H12Cl2N2O |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 2-chloro-N-[2-(4-chlorophenyl)phenyl]pyridine-3-carboxamide |
| InChI | InChI=1S/C18H12Cl2N2O/c19-13-9-7-12(8-10-13)14-4-1-2-6-16(14)22-18(23)15-5-3-11-21-17(15)20/h1-11H,(H,22,23) |
| InChIKey | WYEMLYFITZORAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Cl)NC(=O)C3=C(N=CC=C3)Cl |
| Reference | <p> |
