For research use only. Not for therapeutic Use.
Bosentan（Cat No.:I001805）is a dual endothelin receptor antagonist used primarily to treat pulmonary arterial hypertension (PAH). It works by blocking the action of endothelin-1, a substance that causes blood vessels to constrict and leads to increased blood pressure. By dilating blood vessels, Bosentan helps reduce blood pressure in the lungs, improving exercise capacity and slowing disease progression. It is also being studied for potential applications in other vascular diseases. As a key pharmaceutical agent, Bosentan plays a crucial role in cardiovascular research and treatment development.
| Catalog Number | I001805 |
| CAS Number | 147536-97-8 |
| Synonyms | 4-tert-butyl-N-[6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]benzenesulfonamide |
| Molecular Formula | C₂₇H₂₉N₅O₆S |
| Purity | ≥95% |
| Target | Endothelin Receptor |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20C |
| IUPAC Name | 4-tert-butyl-N-[6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]benzenesulfonamide |
| InChI | InChI=1S/C27H29N5O6S/c1-27(2,3)18-10-12-19(13-11-18)39(34,35)32-23-22(38-21-9-6-5-8-20(21)36-4)26(37-17-16-33)31-25(30-23)24-28-14-7-15-29-24/h5-15,33H,16-17H2,1-4H3,(H,30,31,32) |
| InChIKey | GJPICJJJRGTNOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NC2=C(C(=NC(=N2)C3=NC=CC=N3)OCCO)OC4=CC=CC=C4OC |
