For research use only. Not for therapeutic Use.
BPDBA (Cat No.:I023635) is an organic compound often studied for its potential applications in materials science and organic electronics. It is a highly conjugated molecule, which gives it interesting optical and electronic properties, making it a candidate for use in organic light-emitting diodes (OLEDs), photovoltaic devices, and other optoelectronic applications. BPDBA is also examined for its role in fluorescence and its ability to form specific interactions with other molecules, including in the study of molecular recognition and supramolecular chemistry. Research into its stability, efficiency, and performance is ongoing for various technological applications.
| CAS Number | 312281-74-6 |
| Synonyms | N-(1-benzylpiperidin-4-yl)-2,4-dichlorobenzamide |
| Molecular Formula | C19H20Cl2N2O |
| Purity | ≥95% |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2,4-dichlorobenzamide |
| InChI | InChI=1S/C19H20Cl2N2O/c20-15-6-7-17(18(21)12-15)19(24)22-16-8-10-23(11-9-16)13-14-4-2-1-3-5-14/h1-7,12,16H,8-11,13H2,(H,22,24) |
| InChIKey | OIDACLQVAGIDMT-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1NC(=O)C2=C(C=C(C=C2)Cl)Cl)CC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
