For research use only. Not for therapeutic Use.
BPN-15477（Cat No.:I043516）is a selective and potent inhibitor of the dopamine transporter (DAT), primarily used in neuroscience research. By blocking DAT, BPN-15477 increases dopamine levels in the brain, which has potential therapeutic applications for neuropsychiatric disorders, such as attention deficit hyperactivity disorder (ADHD) and Parkinson’s disease. Its ability to selectively modulate dopamine neurotransmission makes BPN-15477 valuable for studying dopamine-related pathways and brain function. In preclinical studies, it has also demonstrated potential as a tool to investigate addiction and other neurodegenerative diseases associated with dopamine dysregulation.
| CAS Number | 1971086-99-3 |
| Synonyms | 2-chloro-N-(pyridin-4-ylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| Molecular Formula | C12H10ClN5 |
| Purity | ≥95% |
| IUPAC Name | 2-chloro-N-(pyridin-4-ylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| InChI | InChI=1S/C12H10ClN5/c13-12-17-10-9(3-6-15-10)11(18-12)16-7-8-1-4-14-5-2-8/h1-6H,7H2,(H2,15,16,17,18) |
| InChIKey | JAAXPOGNLKNTBW-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=NC(=N2)Cl)NCC3=CC=NC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
