For research use only. Not for therapeutic Use.
BPTES-d10(Cat No.:R031357)is a deuterated compound featuring ten deuterium atoms, essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of BPTES is crucial for studying its pharmacokinetics, metabolic pathways, and interactions as a glutaminase inhibitor. Its stable isotope labeling ensures precise and reliable analytical results, making it ideal for mass spectrometry and NMR applications. With enhanced stability and consistency, BPTES-d10 integrates seamlessly into various experimental setups, providing a robust solution for high-precision scientific investigations. Perfect for cancer research and metabolic studies, it supports cutting-edge research in medicinal chemistry and drug development.
Catalog Number | R031357 |
CAS Number | NA |
Synonyms | N,N’-[Thiobis(2,1-ethanediyl-1,3,4-thiadiazole-5,2-diyl)]bis-benzeneacetamide-d10 |
Molecular Formula | C₂₄H₁₄D₁₀N₆O₂S₃ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-N-[5-[2-[2-[5-[[2-(2,3,4,5,6-pentadeuteriophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]acetamide |
InChI | InChI=1S/C24H24N6O2S3/c31-19(15-17-7-3-1-4-8-17)25-23-29-27-21(34-23)11-13-33-14-12-22-28-30-24(35-22)26-20(32)16-18-9-5-2-6-10-18/h1-10H,11-16H2,(H,25,29,31)(H,26,30,32)/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
InChIKey | MDJIPXYRSZHCFS-LHNTUAQVSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CC(=O)NC2=NN=C(S2)CCSCCC3=NN=C(S3)NC(=O)CC4=C(C(=C(C(=C4[2H])[2H])[2H])[2H])[2H])[2H])[2H] |