For research use only. Not for therapeutic Use.
Bracco 15000 (Cat.No:L003469) is a specialized contrast agent used in medical imaging, particularly in magnetic resonance imaging (MRI). It contains gadolinium, enhancing the visibility of internal body structures during scans. This compound is known for its high stability and low toxicity, making it a preferred choice for diagnostic purposes.
CAS Number | 60208-45-9 |
Molecular Formula | C17H22I3N3O8 |
Purity | ≥95% |
IUPAC Name | 1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-5-(2-hydroxypropanoylamino)-2,4,6-triiodobenzene-1,3-dicarboxamide |
InChI | InChI=1S/C17H22I3N3O8/c1-6(28)15(29)23-14-12(19)9(16(30)21-7(2-24)3-25)11(18)10(13(14)20)17(31)22-8(4-26)5-27/h6-8,24-28H,2-5H2,1H3,(H,21,30)(H,22,31)(H,23,29) |
InChIKey | XQZXYNRDCRIARQ-UHFFFAOYSA-N |
SMILES | CC(C(=O)NC1=C(C(=C(C(=C1I)C(=O)NC(CO)CO)I)C(=O)NC(CO)CO)I)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |