For research use only. Not for therapeutic Use.
Braco-19 trihydrochloride(Cat No.:I011162)is a powerful inhibitor of telomerase and telomeres, crucial components for maintaining the integrity and length of telomeres. By preventing the catalytic activity of telomerase, Braco-19 trihydrochloride disrupts the process of telomere extension and stability. It functions as a quadruplet (GQ) binding ligand, promoting the formation of GQ structures at telomeric DNA. This can induce rapid senescence or selective cell death. Additionally, Braco-19 trihydrochloride inhibits the replication of HAdV (human adenovirus), making it potentially useful for antiviral therapies.
CAS Number | 1177798-88-7 |
Synonyms | N,N/’-[9[[4-(Dimethylamino)phenyl]amino]-3,6-acridinediyl]bis-1-pyrrolidinepropanamide trihydrochloride |
Molecular Formula | C35H46Cl3N7O2 |
Purity | ≥95% |
Target | Anti-infection |
Solubility | Soluble to 50 mM in water and to 50 mM in DMSO |
Storage | Store at 2-8°C |
IUPAC Name | N-[9-[4-(dimethylamino)anilino]-6-(3-pyrrolidin-1-ylpropanoylamino)acridin-3-yl]-3-pyrrolidin-1-ylpropanamide;trihydrochloride |
InChI | InChI=1S/C35H43N7O2.3ClH/c1-40(2)28-11-7-25(8-12-28)38-35-29-13-9-26(36-33(43)15-21-41-17-3-4-18-41)23-31(29)39-32-24-27(10-14-30(32)35)37-34(44)16-22-42-19-5-6-20-42;;;/h7-14,23-24H,3-6,15-22H2,1-2H3,(H,36,43)(H,37,44)(H,38,39);3*1H |
InChIKey | MJAPNWJRLLDPAB-UHFFFAOYSA-N |
SMILES | CN(C)C1=CC=C(C=C1)NC2=C3C=CC(=CC3=NC4=C2C=CC(=C4)NC(=O)CCN5CCCC5)NC(=O)CCN6CCCC6.Cl.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |