For research use only. Not for therapeutic Use.
Branebrutinib（Cat No.:I019893）is a selective Bruton’s tyrosine kinase (BTK) inhibitor, primarily studied for its potential in treating autoimmune diseases and certain cancers. BTK is a key enzyme in B-cell receptor signaling, which plays a crucial role in immune cell activation. By inhibiting BTK, branebrutinib can reduce excessive immune responses in conditions like rheumatoid arthritis, lupus, and other autoimmune disorders. It is also being explored in hematological cancers, such as B-cell lymphomas, where it may help control tumor growth. Clinical trials are ongoing to assess its safety, efficacy, and broader therapeutic applications.
| Catalog Number | I019893 |
| CAS Number | 1912445-55-6 |
| Molecular Formula | C₂₀H₂₃FN₄O₂ |
| Purity | ≥95% |
| Target | Btk |
| IUPAC Name | 4-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide |
| InChI | InChI=1S/C20H23FN4O2/c1-4-6-16(26)24-13-7-5-8-25(10-13)19-15(21)9-14(20(22)27)18-17(19)11(2)12(3)23-18/h9,13,23H,5,7-8,10H2,1-3H3,(H2,22,27)(H,24,26)/t13-/m0/s1 |
| InChIKey | VJPPLCNBDLZIFG-ZDUSSCGKSA-N |
| SMILES | CC#CC(=O)N[C@H]1CCCN(C1)C2=C(C=C(C3=C2C(=C(N3)C)C)C(=O)N)F |
