For research use only. Not for therapeutic Use.
Brassinolide(CAT: I004718) is a plant steroid hormone (brassinosteroid) that plays a crucial role in promoting plant growth and development. It is involved in various physiological processes such as cell elongation, division, differentiation, and stress response. Brassinolide enhances plant resistance to environmental stresses like drought, high salinity, and extreme temperatures. It also promotes flowering, fruit development, and improves overall crop yield and quality. As a natural growth regulator, Brassinolide is widely used in agricultural practices to enhance plant productivity and resilience. Its unique ability to stimulate growth at low concentrations makes it a valuable tool for improving plant health and agricultural outcomes.
Catalog Number | I004718 |
CAS Number | 72962-43-7 |
Synonyms | (3aS,5S,6R,7aR,7bS,9aS,10R,12aS,12bS)-10-((2S,3R,4R,5S)-3,4-dihydroxy-5,6-dimethylheptan-2-yl)-5,6-dihydroxy-7a,9a-dimethyltetradecahydro-1H-benzo[c]indeno[5,4-e]oxepin-3(12bH)-one |
Molecular Formula | C28H48O6 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 5.2 mg/mL |
Storage | Store at -20°C |
IUPAC Name | (1S,2R,4R,5S,7S,11S,12S,15R,16S)-15-[(2S,3R,4R,5S)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one |
InChI | 1S/C28H48O6/c1-14(2)15(3)24(31)25(32)16(4)18-7-8-19-17-13-34-26(33)21-11-22(29)23(30)12-28(21,6)20(17)9-10-27(18,19)5/h14-25,29-32H,7-13H2,1-6H3/t15-,16-,17-,18+,19-,20-,21+,22-,23+,24+,25+,27+,28+/m0/s1 |
InChIKey | IXVMHGVQKLDRKH-KNBKMWSGSA-N |
SMILES | C[C@@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2COC(=O)[C@@H]4[C@@]3(C[C@H]([C@H](C4)O)O)C)C)[C@H]([C@@H]([C@@H](C)C(C)C)O)O |