For research use only. Not for therapeutic Use.
Brazilein (Cat.No:I012762) is a natural compound found in the heartwood of the Caesalpinia sappan tree. It has been used in traditional medicine for its anti-inflammatory, antioxidant, and antimicrobial properties. In research studies, Brazilein has shown potential in treating cancer, diabetes, and cardiovascular diseases. It is also used as a natural colorant in the food and cosmetic industries. Brazilein is a promising natural compound with various potential therapeutic applications.
| Catalog Number | I012762 |
| CAS Number | 600-76-0 |
| Synonyms | 6a,7-Dihydro-3,6a,10-trihydroxy-benz[b] |
| Molecular Formula | C16H12O5 |
| Purity | ≥95% |
| IUPAC Name | 6a,9,10-trihydroxy-6,7-dihydroindeno[2,1-c]chromen-3-one |
| InChI | InChI=1S/C16H12O5/c17-9-1-2-10-14(4-9)21-7-16(20)6-8-3-12(18)13(19)5-11(8)15(10)16/h1-5,18-20H,6-7H2 |
| InChIKey | PGERTGWKXFAEFR-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2C3=C4C=CC(=O)C=C4OCC31O)O)O |
