For research use only. Not for therapeutic Use.
BRD-73954(Cat No.:I001697)is a selective small-molecule inhibitor of the P97 ATPase (valosin-containing protein, VCP), which plays a crucial role in protein homeostasis, particularly in protein degradation and the unfolded protein response. By inhibiting P97, BRD-73954 disrupts the degradation of misfolded proteins, leading to the accumulation of toxic proteins and inducing cell stress, making it a valuable tool in cancer research. This compound is studied for its potential to impair protein quality control mechanisms in cancer cells, offering insights into novel therapeutic approaches targeting protein degradation pathways.
CAS Number | 1440209-96-0 |
Synonyms | N1-hydroxy-N3-(2-phenylethyl)-1,3-benzenedicarboxamide |
Molecular Formula | C₁₆H₁₆N₂O₃ |
Purity | ≥95% |
Target | Epigenetics |
Solubility | DMSO: ≥ 35 mg/mL |
Storage | -20°C |
IC50 | 36 nM (HDAC6), 120 nM (HDAC8) |
IUPAC Name | 3-N-hydroxy-1-N-(2-phenylethyl)benzene-1,3-dicarboxamide |
InChI | InChI=1S/C16H16N2O3/c19-15(17-10-9-12-5-2-1-3-6-12)13-7-4-8-14(11-13)16(20)18-21/h1-8,11,21H,9-10H2,(H,17,19)(H,18,20) |
InChIKey | FIHKWEQJEDRIFS-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CCNC(=O)C2=CC(=CC=C2)C(=O)NO |
Reference | <p style=/line-height:25px/> |