For research use only. Not for therapeutic Use.
BRD2879(Cat No.:I004955) is a small molecule inhibitor designed to target specific enzymes or pathways within cells, particularly those involved in cancer progression and metastasis. While detailed information about the specific target and mechanism of action of BRD2879 remains sparse in the publicly available literature, such compounds typically focus on inhibiting pathways that are crucial for cancer cell survival and proliferation. BRD2879’s development is part of ongoing research efforts to discover novel therapeutic agents that can offer targeted treatment options for various cancer types, aiming to improve efficacy and reduce side effects compared to traditional chemotherapy.
CAS Number | 1304750-47-7 |
Synonyms | BRD2879; BRD-2879; BRD 2879.;3-cyclohexyl-1-(((4R,5R)-8-((3-fluorophenyl)ethynyl)-2-((S)-1-hydroxypropan-2-yl)-4-methyl-1,1-dioxido-2,3,4,5-tetrahydrobenzo[b][1,4,5]oxathiazocin-5-yl)methyl)-1-methylurea |
Molecular Formula | C30H38FN3O5S |
Purity | ≥95% |
Target | IDH1 inhibitor |
Solubility | Soluble in DMSO |
Storage | 0 - 4 °C for short term or -20 °C for long term |
IUPAC Name | 3-cyclohexyl-1-[[(4R,5R)-8-[2-(3-fluorophenyl)ethynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
InChI | InChI=1S/C30H38FN3O5S/c1-21-18-34(22(2)20-35)40(37,38)29-15-14-24(13-12-23-8-7-9-25(31)16-23)17-27(29)39-28(21)19-33(3)30(36)32-26-10-5-4-6-11-26/h7-9,14-17,21-22,26,28,35H,4-6,10-11,18-20H2,1-3H3,(H,32,36)/t21-,22+,28+/m1/s1 |
InChIKey | YAJYINBQFXCAPI-WENCSYSZSA-N |
SMILES | CC1CN(S(=O)(=O)C2=C(C=C(C=C2)C#CC3=CC(=CC=C3)F)OC1CN(C)C(=O)NC4CCCCC4)C(C)CO |