For research use only. Not for therapeutic Use.
BRD4-IN-4(Cat No.:I041078)is a selective small molecule inhibitor that targets BRD4 (bromodomain-containing protein 4), a key regulator of gene expression involved in the transcriptional activation of oncogenes. By inhibiting BRD4, BRD4-IN-4 disrupts the interaction between BRD4 and acetylated histones, preventing the transcription of genes that promote cancer cell growth, survival, and metastasis. This compound has demonstrated potential in preclinical studies for treating various cancers, including hematologic malignancies and solid tumors. Its ability to specifically target BRD4 makes it a promising candidate for targeted cancer therapies.
CAS Number | 304685-40-3 |
Synonyms | 1-ethyl-6-pyrrolidin-1-ylsulfonylbenzo[cd]indol-2-one |
Molecular Formula | C17H18N2O3S |
Purity | ≥95% |
IUPAC Name | 1-ethyl-6-pyrrolidin-1-ylsulfonylbenzo[cd]indol-2-one |
InChI | InChI=1S/C17H18N2O3S/c1-2-19-14-8-9-15(23(21,22)18-10-3-4-11-18)12-6-5-7-13(16(12)14)17(19)20/h5-9H,2-4,10-11H2,1H3 |
InChIKey | HTONIJRZZRKKQF-UHFFFAOYSA-N |
SMILES | CCN1C2=C3C(=C(C=C2)S(=O)(=O)N4CCCC4)C=CC=C3C1=O |