For research use only. Not for therapeutic Use.
BRD56491 is a nontoxic enhancer of reactive oxygen species (ROS) that strongly elevates markers of oxidative stress without causing cell death. Elevation of reactive oxygen species (ROS) levels has been observed in many cancer cells relative to nontransformed cells, and recent reports have suggested that small-molecule enhancers of ROS may selectively kill cancer cells in various in vitro and in vivo models
| Catalog Number | I004971 |
| CAS Number | 14756-26-4 |
| Synonyms | BRD56491; BRD-56491; BRD 56491.;2-(4-Methylphenyl)-4H-benzo[h]chromen-4-one |
| Molecular Formula | C20H14O2 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term ,or -20 °C for long term |
| InChI | InChI=1S/C20H14O2/c1-13-6-8-15(9-7-13)19-12-18(21)17-11-10-14-4-2-3-5-16(14)20(17)22-19/h2-12H,1H3 |
| InChIKey | AVCQGCNOJZYRJO-UHFFFAOYSA-N |
| SMILES | O=C1C=C(C2=CC=C(C)C=C2)OC3=C1C=CC4=CC=CC=C43 |
