For research use only. Not for therapeutic Use.
BRD56491(CAT: I004971) is a non-toxic small molecule that enhances reactive oxygen species (ROS), significantly increasing oxidative stress markers without inducing cell death in normal cells. By selectively elevating ROS levels, BRD56491 exploits the heightened oxidative stress observed in many cancer cells compared to non-transformed cells. This property makes it a promising tool for cancer research, particularly in studying redox biology and developing therapies that target the vulnerability of cancer cells to oxidative stress. BRD56491 provides insights into ROS-mediated cellular pathways and holds potential for advancing therapeutic strategies that selectively kill cancer cells by amplifying oxidative damage.
CAS Number | 14756-26-4 |
Synonyms | BRD56491; BRD-56491; BRD 56491.;2-(4-Methylphenyl)-4H-benzo[h]chromen-4-one |
Molecular Formula | C20H14O2 |
Purity | ≥95% |
Solubility | Soluble in DMSO |
Storage | 0 - 4°C for short term ,or -20 °C for long term |
IUPAC Name | 2-(4-methylphenyl)benzo[h]chromen-4-one |
InChI | InChI=1S/C20H14O2/c1-13-6-8-15(9-7-13)19-12-18(21)17-11-10-14-4-2-3-5-16(14)20(17)22-19/h2-12H,1H3 |
InChIKey | AVCQGCNOJZYRJO-UHFFFAOYSA-N |
SMILES | O=C1C=C(C2=CC=C(C)C=C2)OC3=C1C=CC4=CC=CC=C43 |