For research use only. Not for therapeutic Use.
BRD6989（Cat No.:I017631） is a high-purity chemical compound essential for cutting-edge pharmaceutical and biochemical research. Known for its role as a potent inhibitor, BRD6989 is crucial for studies on protein interactions, cellular signaling pathways, and drug discovery. Its precise formulation ensures accurate and reproducible results in complex biological systems. BRD6989 is a valuable tool for scientific investigations, advancing research in disease treatment and enhancing our understanding of biochemical processes.
| Catalog Number | I017631 |
| CAS Number | 642008-81-9 |
| Molecular Formula | C₁₆H₁₆N₄ |
| Purity | ≥95% |
| Target | Immunology/Inflammation |
| IUPAC Name | 2-amino-6-methyl-4-pyridin-3-yl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| InChI | InChI=1S/C16H16N4/c1-10-4-5-14-12(7-10)15(11-3-2-6-19-9-11)13(8-17)16(18)20-14/h2-3,6,9-10H,4-5,7H2,1H3,(H2,18,20) |
| InChIKey | QSYBDNXNOJIKML-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)C(=C(C(=N2)N)C#N)C3=CN=CC=C3 |
