For research use only. Not for therapeutic Use.
BRD7116 (Cat No.: I003173) is a potent compound that competitively binds to bacterial DNA gyrase. It exhibits significant activity against LSCe cells, with an EC50 value of 200 nM, making it a promising candidate for leukemia treatment. Additionally, BRD7116 demonstrates non-autonomous anti-leukemia activity, suggesting its potential for combination therapies. For further information or specific inquiries regarding BRD7116, please feel free to contact us.
| Catalog Number | I003173 |
| CAS Number | 329059-55-4 |
| Synonyms | N,N/’-(sulfonyldi-4,1-phenylene)<em>bis</em>[2,2,3,3-tetramethyl-cyclopropanecarboxamide |
| Molecular Formula | C₂₈H₃₆N₂O₄S |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | DMSO: ≥ 48 mg/mL |
| Storage | 2-8°C |
| IC50 | 200 nM (EC50, for LSCe cells) |
| IUPAC Name | 2,2,3,3-tetramethyl-N-[4-[4-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]phenyl]sulfonylphenyl]cyclopropane-1-carboxamide |
| InChI | InChI=1S/C28H36N2O4S/c1-25(2)21(26(25,3)4)23(31)29-17-9-13-19(14-10-17)35(33,34)20-15-11-18(12-16-20)30-24(32)22-27(5,6)28(22,7)8/h9-16,21-22H,1-8H3,(H,29,31)(H,30,32) |
| InChIKey | UHXFWAHRAMUDLJ-UHFFFAOYSA-N |
| SMILES | CC1(C(C1(C)C)C(=O)NC2=CC=C(C=C2)S(=O)(=O)C3=CC=C(C=C3)NC(=O)C4C(C4(C)C)(C)C)C |
