For research use only. Not for therapeutic Use.
Brevetoxin PbTx-1 is a potent neurotoxin produced by the marine dinoflagellate Karenia brevis, known for causing red tide events. This toxin binds to voltage-gated sodium channels in nerve cells, leading to their persistent activation, which can result in neurotoxic shellfish poisoning (NSP) when contaminated seafood is consumed. Brevetoxin PbTx-1 is a major focus in marine toxicology and environmental monitoring due to its impact on marine ecosystems, human health, and the economic effects on the fishing and tourism industries.
Catalog Number | T000080 |
CAS Number | 98112-41-5 |
Molecular Formula | C49H70O13 |
Purity | ≥95% |
Solubility | In acetone, ethyl acetate, methanol (decomp.), ethanol (decomp.), water |
Storage | at -20°C |
InChI | InChI=1S/C49H70O13/c1-26-17-36-39(22-45(52)58-36)57-44-21-38-40(62-48(44,4)23-26)18-28(3)46-35(55-38)11-7-6-10-31-32(59-46)12-8-14-34-33(54-31)13-9-15-43-49(5,61-34)24-42-37(56-43)20-41-47(60-42)30(51)19-29(53-41)16-27(2)25-50/h6-8,14,25-26,28-44,46-47,51H,2,9-13,15-24H2,1,3-5H3/b7-6-,14-8-/t26-,28+,29-,30+,31-,32+,33+,34-,35+,36+,37+,38-,39-,40+,41-,42-,43-,44+,46-,47+,48-,49+/m1/s1 |
InChIKey | MGVIMUPHKPHTKF-HQUFVKSZSA-N |
SMILES | CC1CC2C(CC(=O)O2)OC3CC4C(CC(C5C(O4)CC=CCC6C(O5)CC=CC7C(O6)CCCC8C(O7)(CC9C(O8)CC2C(O9)C(CC(O2)CC(=C)C=O)O)C)C)OC3(C1)C |