For research use only. Not for therapeutic Use.
Brevianamide F(Cat No.:I003401)is an indole alkaloid produced by various fungal species, including Penicillium and Aspergillus. It belongs to the diketopiperazine class of compounds and has drawn significant interest for its unique chemical structure and potential biological activities. Brevianamide F has demonstrated antimicrobial, antifungal, and cytotoxic properties, making it a valuable target for drug discovery research. Its biosynthetic pathway is also of interest, as it provides insights into fungal secondary metabolite production. Studies continue to explore its potential therapeutic applications, particularly in cancer and infectious disease research.
CAS Number | 38136-70-8 |
Molecular Formula | C16H17N3O2 |
Purity | 95% |
Target | Anti-infection |
Solubility | 10 mM in DMSO |
Appearance | White solid |
Storage | Store at +4C |
Analysis method | HPLC |
IUPAC Name | (3S,8aS)-3-(1H-indol-3-ylmethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
InChI | InChI=1S/C16H17N3O2/c20-15-14-6-3-7-19(14)16(21)13(18-15)8-10-9-17-12-5-2-1-4-11(10)12/h1-2,4-5,9,13-14,17H,3,6-8H2,(H,18,20)/t13-,14-/m0/s1 |
InChIKey | RYFZBPVMVYTEKZ-KBPBESRZSA-N |
SMILES | C1C[C@H]2C(=O)N[C@H](C(=O)N2C1)CC3=CNC4=CC=CC=C43 |
Reference | <br /> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |