For research use only. Not for therapeutic Use.
Brevilin A(Cat No.:M128163)is a bioactive compound derived from the fungus Curvularia lunata, known for its diverse pharmacological properties. It exhibits significant anticancer activity by inducing apoptosis and inhibiting cell proliferation in various cancer cell lines. Additionally, brevilin A possesses anti-inflammatory and antimicrobial effects, contributing to its therapeutic potential. Research has shown its ability to modulate multiple signaling pathways, enhancing its effectiveness against tumors. Brevilin A’s unique mechanism of action and its origin from natural sources make it a promising candidate for further investigation in cancer treatment and other biomedical applications.
CAS Number | 16503-32-5 |
Synonyms | Brevilin A |
Molecular Formula | C20H26O5 |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Storage | Store at -20°C |
IUPAC Name | [(1S,3aR,5R,5aR,8aR,9S,9aR)-1,5,8a-trimethyl-2,8-dioxo-3a,4,5,5a,9,9a-hexahydro-1H-azuleno[6,5-b]furan-9-yl] (Z)-2-methylbut-2-enoate |
InChI | InChI=1S/C20H26O5/c1-6-10(2)18(22)25-17-16-12(4)19(23)24-14(16)9-11(3)13-7-8-15(21)20(13,17)5/h6-8,11-14,16-17H,9H2,1-5H3/b10-6-/t11-,12+,13+,14-,16-,17+,20+/m1/s1 |
InChIKey | KUPPZVXLWANEJJ-UXPPPGSFSA-N |
SMILES | C/C=C(/C)\C(=O)O[C@H]1[C@@H]2[C@@H](C(=O)O[C@@H]2C[C@H]([C@H]3[C@]1(C(=O)C=C3)C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |