For research use only. Not for therapeutic Use.
BRM/BRG1 ATP Inhibitor-2（Cat No.:I043840）is a small molecule inhibitor designed to target BRM (Brahma) and BRG1 (SWI/SNF-related matrix-associated actin-dependent regulator of chromatin) ATPases, which are critical components of the SWI/SNF chromatin remodeling complex. This complex plays a key role in regulating gene expression and maintaining cellular homeostasis. By inhibiting BRM and BRG1 ATPases, BRM/BRG1 ATP Inhibitor-2 aims to disrupt the chromatin remodeling process, potentially leading to the reactivation of tumor suppressor genes and inhibition of cancer cell proliferation. It holds promise as a therapeutic agent for treating cancers with SWI/SNF complex mutations.
| CAS Number | 2368900-77-8 |
| Synonyms | N-[(2S)-4-methylsulfanyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]butan-2-yl]pyridine-3-carboxamide |
| Molecular Formula | C20H20N4O2S2 |
| Purity | ≥95% |
| IUPAC Name | N-[(2S)-4-methylsulfanyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]butan-2-yl]pyridine-3-carboxamide |
| InChI | InChI=1S/C20H20N4O2S2/c1-27-11-9-16(22-18(25)15-8-5-10-21-12-15)19(26)24-20-23-17(13-28-20)14-6-3-2-4-7-14/h2-8,10,12-13,16H,9,11H2,1H3,(H,22,25)(H,23,24,26)/t16-/m0/s1 |
| InChIKey | MVXCBDXYQGDDNA-INIZCTEOSA-N |
| SMILES | CSCC[C@@H](C(=O)NC1=NC(=CS1)C2=CC=CC=C2)NC(=O)C3=CN=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
