For research use only. Not for therapeutic Use.
Brodimoprim (Cat No.:R053350) is a synthetic antimicrobial agent belonging to the diaminopyrimidine class. It acts by inhibiting the enzyme dihydrofolate reductase (DHFR), crucial for bacterial cell growth and replication. By disrupting folate synthesis, brodimoprim inhibits bacterial DNA synthesis and cell division. Often used in combination with sulfamethoxazole as co-trimoxazole (TMP-SMX), brodimoprim demonstrates broad-spectrum antibacterial activity against various infections. It is commonly prescribed for urinary tract infections, respiratory tract infections, and skin and soft tissue infections.
| Catalog Number | R053350 |
| CAS Number | 56518-41-3 |
| Synonyms | 5-[(4-Bromo-3,5-dimethoxyphenyl)methyl]-2,4-pyrimidinediamine; 5-(4-Bromo-3,5-dimethoxybenzyl)-2,4-pyrimidinediamine;Hyprim; Ro 10-5970; Ro 105970; Unitrim; |
| Molecular Formula | C13H15BrN4O2 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | Store at -20°C |
| IUPAC Name | 5-[(4-bromo-3,5-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
| InChI | InChI=1S/C13H15BrN4O2/c1-19-9-4-7(5-10(20-2)11(9)14)3-8-6-17-13(16)18-12(8)15/h4-6H,3H2,1-2H3,(H4,15,16,17,18) |
| InChIKey | BFCRRLMMHNLSCP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1Br)OC)CC2=CN=C(N=C2N)N |
