For research use only. Not for therapeutic Use.
Bromadoline, also known as U-47931E, is an opioid analgesic selective for the μ-opioid receptor[2] developed by the Upjohn company in the 1970s. The drug has a potency lying between that of codeine and morphine, being slightly stronger than pentazocine. Bromadoline is related to AH-7921 and U-47700.
| Catalog Number | I005025 |
| CAS Number | 81447-81-6 (maleate) |
| Synonyms | Bromadoline; U-47931E; U 47931E; U47931E; U 47,931E; U47,931E; U-47,931E; Bromadoline maleate;4-bromo-N-((1R,2R)-2-(dimethylamino)cyclohexyl)benzamide maleate |
| Molecular Formula | C19H25BrN2O5 |
| Purity | ≥95% |
| Target | µ-opioid receptor agonist |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term ,or -20 °C for long term |
| InChI | InChI=1S/C15H21BrN2O.C4H4O4/c1-18(2)14-6-4-3-5-13(14)17-15(19)11-7-9-12(16)10-8-11;5-3(6)1-2-4(7)8/h7-10,13-14H,3-6H2,1-2H3,(H,17,19);1-2H,(H,5,6)(H,7,8)/b;2-1-/t13-,14-;/m1./s1 |
| InChIKey | XHCXKGFNPZETQY-VAYAAYOLSA-N |
| SMILES | O=C(N[C@H]1[C@H](N(C)C)CCCC1)C2=CC=C(Br)C=C2 |
| Reference | </br>1: Hayes AG, Skingle M, Tyers MB. Evaluation of the receptor selectivities of</br> opioid drugs by investigating the block of their effect on urine output by</br> beta-funaltrexamine. J Pharmacol Exp Ther. 1987 Mar;240(3):984-8. PubMed PMID: 3559988. |
