For research use only. Not for therapeutic Use.
Bromantane-d5 is a high-purity, deuterium-labeled derivative of bromantane, essential for advanced pharmaceutical and biochemical research. This compound, featuring five deuterium atoms, is crucial for studying drug metabolism, pharmacokinetics, and neuroprotective mechanisms. Its stable isotope labeling ensures precise and reliable results in mass spectrometry and NMR spectroscopy. Ideal for cutting-edge research in cognitive enhancement and neuroprotection, Bromantane-d5 enhances the accuracy of experimental data, supporting the development of therapeutic strategies and drug efficacy studies.
| Catalog Number | R054767 |
| CAS Number | 1794737-27-1 |
| Synonyms | N-(4-Bromophenyl-d5)tricyclo[3.3.1.13,7]decan-2-amine; Bromantan-d5; N-(2-Adamantyl)-N-(4-bromophenyl-d5)amine; |
| Molecular Formula | C16H20BrN |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-(4-bromo-2,3,5,6-tetradeuteriophenyl)-2-deuterioadamantan-2-amine |
| InChI | InChI=1S/C16H20BrN/c17-14-1-3-15(4-2-14)18-16-12-6-10-5-11(8-12)9-13(16)7-10/h1-4,10-13,16,18H,5-9H2/i1D,2D,3D,4D,16D |
| InChIKey | LWJALJDRFBXHKX-IPPIDYIJSA-N |
| SMILES | C1C2CC3CC1CC(C2)C3NC4=CC=C(C=C4)Br |
