For research use only. Not for therapeutic Use.
Bromantane（Cat No.:R054764）is a synthetic adaptogen and actoprotector originally developed in Russia. It is known for its dual action as both a stimulant and anxiolytic, enhancing physical and mental performance without the typical side effects of stimulants. Bromantane works by modulating the dopaminergic and serotonergic systems, improving mood, reducing anxiety, and increasing energy levels. It is used to combat fatigue, improve cognitive function, and enhance endurance. Its unique profile has led to its use in various contexts, from athletic performance enhancement to recovery from stress and fatigue.
| Catalog Number | R054764 |
| CAS Number | 87913-26-6 |
| Synonyms | N-(4-Bromophenyl)tricyclo[3.3.1.13,7]decan-2-amine; Bromantan; N-(2-Adamantyl)-N-(4-bromophenyl)amine; |
| Molecular Formula | C16H20BrN |
| Purity | ≥95% |
| Storage | -20°C |
| Related CAS | 16292-17-4 106-37-6 589-21-9 6911-87-1 |
| IUPAC Name | N-(4-bromophenyl)adamantan-2-amine |
| InChI | InChI=1S/C16H20BrN/c17-14-1-3-15(4-2-14)18-16-12-6-10-5-11(8-12)9-13(16)7-10/h1-4,10-13,16,18H,5-9H2 |
| InChIKey | LWJALJDRFBXHKX-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)C3NC4=CC=C(C=C4)Br |
