Bromoacetic-1-13C Acid is an isotopically labeled form of bromoacetic acid, with a carbon-13 isotope specifically incorporated at the first carbon position. This high-purity compound is essential for research in organic chemistry, biochemistry, and environmental science. Bromoacetic-1-13C Acid is particularly valuable for studying reaction mechanisms, metabolic pathways, and the environmental fate of haloacetic acids. The carbon-13 labeling enables precise tracking and quantification in NMR spectroscopy and mass spectrometry, providing enhanced accuracy in tracing chemical transformations and interactions. This compound is a crucial tool for researchers focusing on the synthesis of labeled compounds, metabolic studies, and environmental monitoring, offering consistent and reliable results in various experimental applications.
Catalog Number | R039430 |
CAS Number | 57858-24-9 |
Synonyms | 2-Bromoacetic Acid-13C; 2-Bromoethanoic Acid-13C; |
Molecular Formula | C2H3BrO2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 2-bromoacetic acid |
InChI | InChI=1S/C2H3BrO2/c3-1-2(4)5/h1H2,(H,4,5)/i2+1 |
InChIKey | KDPAWGWELVVRCH-VQEHIDDOSA-N |
SMILES | C([13C](=O)O)Br |