For research use only. Not for therapeutic Use.
Bromoacetic anhydride is an organobromine compound used as a reagent in organic synthesis. It is commonly employed for the introduction of bromoacetyl groups into molecules, facilitating the synthesis of various bioactive compounds, including pharmaceuticals and agrochemicals. Its reactivity with nucleophiles, such as amines and alcohols, makes it valuable in acylation reactions. Bromoacetic anhydride is particularly useful in preparing intermediates for chemical processes, contributing to advancements in medicinal chemistry and the development of fine chemicals and specialized materials.
CAS Number | 13094-51-4 |
Molecular Formula | C4H4Br2O3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | (2-bromoacetyl) 2-bromoacetate |
InChI | InChI=1S/C4H4Br2O3/c5-1-3(7)9-4(8)2-6/h1-2H2 |
InChIKey | FUKOTTQGWQVMQB-UHFFFAOYSA-N |
SMILES | C(C(=O)OC(=O)CBr)Br |