For research use only. Not for therapeutic Use.
Bromochloroacetonitrile(Cat No.:M008768) is a halogenated organic compound, specifically a nitrile, characterized by the presence of both bromine and chlorine atoms attached to an acetonitrile backbone. This chemical is primarily used in organic synthesis as an intermediate. Due to its reactive halogen atoms, it is valuable for introducing bromine and chlorine into other molecules, facilitating various chemical transformations. Bromochloroacetonitrile is also studied for its potential applications in pharmaceuticals and agrochemicals, where it could be used to develop more effective compounds.
CAS Number | 83463-62-1 |
Synonyms | bromochloro-acetonitril;Bromochloromethyl cyanide;BROMOCHLOROACETONITRILE;BROMOCHLOROACETONITRILE 100MG NEAT;bcan |
Molecular Formula | C2HBrClN |
Purity | ≥95% |
Target | DNA/RNA Synthesis |
Storage | Store at -20°C |
IUPAC Name | 2-bromo-2-chloroacetonitrile |
InChI | InChI=1S/C2HBrClN/c3-2(4)1-5/h2H |
InChIKey | BMWPPNAUMLRKML-UHFFFAOYSA-N |
SMILES | C(#N)C(Cl)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |