For research use only. Not for therapeutic Use.
Bromodiphenhydramine hydrochloride（Cat No.:R053196）is a chemical compound that combines the properties of diphenhydramine, a first-generation antihistamine, with a bromine substitution on the phenyl ring. It acts as an H₁ receptor antagonist, effectively blocking histamine activity and reducing allergic symptoms such as itching, sneezing, and swelling. It is used in the treatment of allergies, hay fever, and cold symptoms, and can also have mild sedative effects. The hydrochloride salt form enhances its solubility in water, making it suitable for pharmaceutical applications, including oral or topical formulations for allergy relief.
| CAS Number | 1808-12-4 |
| Synonyms | 2-[(4-bromophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride |
| Molecular Formula | C17H21BrClNO |
| Purity | ≥95% |
| IUPAC Name | 2-[(4-bromophenyl)-phenylmethoxy]-N,N-dimethylethanamine;hydrochloride |
| InChI | InChI=1S/C17H20BrNO.ClH/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15;/h3-11,17H,12-13H2,1-2H3;1H |
| InChIKey | ZQDJSWUEGOYDGT-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC(C1=CC=CC=C1)C2=CC=C(C=C2)Br.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
