For research use only. Not for therapeutic Use.
Bromovanin is a synthetic compound belonging to the class of brominated phenyl derivatives, known for its biological activity. This compound is primarily studied for its potential antimicrobial and antifungal properties, making it of interest in pharmaceutical research. Its unique bromine substituent enhances its reactivity and efficacy against various pathogens. Additionally, Bromovanin serves as a valuable intermediate in organic synthesis, contributing to the development of new therapeutic agents. Ongoing studies aim to further elucidate its mechanisms of action and potential applications in medicine.
| Catalog Number | R049721 |
| CAS Number | 2973-58-2 |
| Synonyms | 2-Bromoisovanillin; 2-Bromo-3-hydroxy-p-anisaldehyde; 2-Bromo-3-hydroxy-4-methoxybenzaldehyde; 2-Bromo-3-formyl-6-methoxyphenol; NSC 12212; NSC 139143; |
| Molecular Formula | C8H7BrO3 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 2-bromo-3-hydroxy-4-methoxybenzaldehyde |
| InChI | InChI=1S/C8H7BrO3/c1-12-6-3-2-5(4-10)7(9)8(6)11/h2-4,11H,1H3 |
| InChIKey | QPDFBPIHEDAUKK-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C=O)Br)O |
