For research use only. Not for therapeutic Use.
Bromoxynil-heptanoate is an herbicide used to control broadleaf weeds in various crops. Its formulation typically includes bromoxynil, a potent synthetic compound that disrupts plant growth by inhibiting photosynthesis. By esterifying bromoxynil with heptanoic acid, its efficacy and persistence can be enhanced, improving weed control. However, like other herbicides, bromoxynil-heptanoate poses risks to non-target organisms and environmental ecosystems. Proper application techniques, adherence to label instructions, and consideration of environmental factors are crucial to minimize potential harm while maximizing its effectiveness in agricultural settings.
CAS Number | 56634-95-8 |
Synonyms | 2,6-Dibromo-4-cyanophenylheptanoate |
Molecular Formula | C14H15Br2NO2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | (2,6-dibromo-4-cyanophenyl) heptanoate |
InChI | InChI=1S/C14H15Br2NO2/c1-2-3-4-5-6-13(18)19-14-11(15)7-10(9-17)8-12(14)16/h7-8H,2-6H2,1H3 |
InChIKey | BHZWBQPHPLFZSV-UHFFFAOYSA-N |
SMILES | CCCCCCC(=O)OC1=C(C=C(C=C1Br)C#N)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |