For research use only. Not for therapeutic Use.
Broussoflavonol B (Cat.No:I012757) is a flavonoid compound found in the leaves of Broussonetia papyrifera, a plant commonly used in traditional medicine. It exhibits various biological activities, including antioxidant, anti-inflammatory, and anticancer properties. Broussoflavonol B has been shown to inhibit the proliferation of cancer cells and induce apoptosis. It may also have potential as a therapeutic agent for inflammatory diseases and neurodegenerative disorders.
CAS Number | 99217-70-6 |
Synonyms | 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one |
Molecular Formula | C26H28O7 |
Purity | ≥95% |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one |
InChI | InChI=1S/C26H28O7/c1-13(2)6-9-16-21(29)17(10-7-14(3)4)25-20(22(16)30)23(31)26(32-5)24(33-25)15-8-11-18(27)19(28)12-15/h6-8,11-12,27-30H,9-10H2,1-5H3 |
InChIKey | WKVKAWWZXXTJEH-UHFFFAOYSA-N |
SMILES | CC(=CCC1=C(C2=C(C(=C1O)CC=C(C)C)OC(=C(C2=O)OC)C3=CC(=C(C=C3)O)O)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |