For research use only. Not for therapeutic Use.
Broussonin E（Cat No.:R011036）is a natural bioactive compound derived from the plant Broussonetia papyrifera. It is a type of flavonoid glycoside with notable pharmacological properties, including antioxidant, anti-inflammatory, and anticancer activities. Research suggests that Broussonin E may help protect cells from oxidative stress, reduce inflammation, and inhibit the growth of cancer cells, making it a potential candidate for therapeutic applications. Studies are ongoing to explore its full spectrum of biological effects and to assess its safety and efficacy in treating various diseases, particularly those associated with oxidative damage and inflammation.
| Catalog Number | R011036 |
| CAS Number | 90902-21-9 |
| Synonyms | 5-[3-(2-hydroxy-4-methoxyphenyl)propyl]-2-methoxyphenol |
| Molecular Formula | C17H20O4 |
| Purity | ≥95% |
| IUPAC Name | 5-[3-(2-hydroxy-4-methoxyphenyl)propyl]-2-methoxyphenol |
| InChI | InChI=1S/C17H20O4/c1-20-14-8-7-13(15(18)11-14)5-3-4-12-6-9-17(21-2)16(19)10-12/h6-11,18-19H,3-5H2,1-2H3 |
| InChIKey | GDCSYNUJDYRGRF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CCCC2=CC(=C(C=C2)OC)O)O |
