For research use only. Not for therapeutic Use.
Broxaldine（Cat No.:I013822）is an antimicrobial agent primarily used in veterinary medicine to treat gastrointestinal infections caused by protozoa and bacteria. It works by disrupting microbial DNA synthesis, inhibiting their replication and survival. Broxaldine is particularly effective against pathogens responsible for enteric diseases in livestock, such as cattle, swine, and poultry, improving animal health and productivity. Its targeted action minimizes resistance development and ensures safe treatment outcomes. As a crucial tool in livestock management, Broxaldine contributes to maintaining the health and welfare of animals in agricultural practices.
| Catalog Number | I013822 |
| CAS Number | 3684-46-6 |
| Molecular Formula | C₁₇H₁₁Br₂NO₂ |
| Purity | ≥95% |
| Target | Parasite |
| Solubility | DMSO: ≥42.86 mg/mL |
| IUPAC Name | (5,7-dibromo-2-methylquinolin-8-yl) benzoate |
| InChI | InChI=1S/C17H11Br2NO2/c1-10-7-8-12-13(18)9-14(19)16(15(12)20-10)22-17(21)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | IJTPLVAAROHGGB-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=CC(=C2OC(=O)C3=CC=CC=C3)Br)Br |
