For research use only. Not for therapeutic Use.
Brucine((-)-Brucine), an alkaloid closely related to strychnine, is most commonly found in the Strychnos nux-vomica tree.This product is a hazardous chemical (acute toxicity/flammable/skin corrosive). Please use it while wearing a protective face mask, gloves, and clothing.
| Catalog Number | I047200 |
| CAS Number | 652154-10-4 |
| Molecular Formula | C23H30N2O9S |
| Purity | ≥95% |
| Storage | 3 years-20°Cpowder |
| SMILES | O.COC1=CC2=C(C=C1OC)C34CCN5CC6=CCOC7CC(=O)N2C3C7C6CC45.O[S](O)(=O)=O |
